C15H16N2O4S2 — CID 87424539
[2-[(4-propan-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 87424539) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is [2-[(4-propan-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(4-propan-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 87424539 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [2-[(4-propan-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1nc(S(=O)C(C)C)cs1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-9(2)23(20)13-8-22-15(16-13)17-14(19)11-6-4-5-7-12(11)21-10(3)18/h4-9H,1-3H3,(H,16,17,19) |
| InChIKey | FYUZZMCJFVWDRG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|