C11H10Cl3NO4 — CID 12922486
[2-[(2,2,2-trichloro-1-hydroxyethyl)carbamoyl]phenyl] acetate (PubChem CID 12922486) has the molecular formula C11H10Cl3NO4 and a molecular weight of 326.56 g/mol. Its IUPAC name is [2-[(2,2,2-trichloro-1-hydroxyethyl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(2,2,2-trichloro-1-hydroxyethyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 12922486 |
| Molecular Formula | C11H10Cl3NO4 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | [2-[(2,2,2-trichloro-1-hydroxyethyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO4/c1-6(16)19-8-5-3-2-4-7(8)9(17)15-10(18)11(12,13)14/h2-5,10,18H,1H3,(H,15,17) |
| InChIKey | QZOTWRLCZFZVIW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|