C9H7Cl4NO2 — CID 3574843
2-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide (PubChem CID 3574843) has the molecular formula C9H7Cl4NO2 and a molecular weight of 302.97 g/mol. Its IUPAC name is 2-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide.
| Compound Name | 2-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 3574843 |
| Molecular Formula | C9H7Cl4NO2 |
| Molecular Weight | 302.97 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | 2-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide |
| SMILES | O=C(NC(O)C(Cl)(Cl)Cl)c1ccccc1Cl |
| InChI | InChI=1S/C9H7Cl4NO2/c10-6-4-2-1-3-5(6)7(15)14-8(16)9(11,12)13/h1-4,8,16H,(H,14,15) |
| InChIKey | SWJIKSUFWGEOBV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|