C9H8Cl4N2O2 — CID 163171091
1-(2-chlorophenyl)-3-[(1S)-2,2,2-trichloro-1-hydroxyethyl]urea (PubChem CID 163171091) has the molecular formula C9H8Cl4N2O2 and a molecular weight of 317.99 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1S)-2,2,2-trichloro-1-hydroxyethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1S)-2,2,2-trichloro-1-hydroxyethyl]urea |
|---|---|
| PubChem CID | 163171091 |
| Molecular Formula | C9H8Cl4N2O2 |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1S)-2,2,2-trichloro-1-hydroxyethyl]urea |
| SMILES | O=C(Nc1ccccc1Cl)N[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl4N2O2/c10-5-3-1-2-4-6(5)14-8(17)15-7(16)9(11,12)13/h1-4,7,16H,(H2,14,15,17)/t7-/m0/s1 |
| InChIKey | VKITWDMZXOQWNC-ZETCQYMHSA-N |
| XLogP | 3.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|