C10H10ClN3O3 — CID 31062751
2-[(2-chlorobenzoyl)amino]propanediamide (PubChem CID 31062751) has the molecular formula C10H10ClN3O3 and a molecular weight of 255.66 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]propanediamide.
| Compound Name | 2-[(2-chlorobenzoyl)amino]propanediamide |
|---|---|
| PubChem CID | 31062751 |
| Molecular Formula | C10H10ClN3O3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]propanediamide |
| SMILES | NC(=O)C(NC(=O)c1ccccc1Cl)C(N)=O |
| InChI | InChI=1S/C10H10ClN3O3/c11-6-4-2-1-3-5(6)10(17)14-7(8(12)15)9(13)16/h1-4,7H,(H2,12,15)(H2,13,16)(H,14,17) |
| InChIKey | KNFQFOBLWFQEQB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|