C13H12N2O4S2 — CID 88570151
ethyl [2-[(4-sulfanyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate (PubChem CID 88570151) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl [2-[(4-sulfanyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [2-[(4-sulfanyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 88570151 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | ethyl [2-[(4-sulfanyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccccc1C(=O)Nc1nc(S)cs1 |
| InChI | InChI=1S/C13H12N2O4S2/c1-2-18-13(17)19-9-6-4-3-5-8(9)11(16)15-12-14-10(20)7-21-12/h3-7,20H,2H2,1H3,(H,14,15,16) |
| InChIKey | KDHTUBWZAORARL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|