C15H16N2O5S2 — CID 87723986
[2,3-dimethyl-6-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 87723986) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is [2,3-dimethyl-6-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2,3-dimethyl-6-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 87723986 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [2,3-dimethyl-6-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C(=O)Nc2nc(S(C)(=O)=O)cs2)ccc(C)c1C |
| InChI | InChI=1S/C15H16N2O5S2/c1-8-5-6-11(13(9(8)2)22-10(3)18)14(19)17-15-16-12(7-23-15)24(4,20)21/h5-7H,1-4H3,(H,16,17,19) |
| InChIKey | XIRUWXCTPNNTFX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|