C15H13F3N2O3S — CID 59581634
[2-methyl-6-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] propanoate (PubChem CID 59581634) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is [2-methyl-6-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] propanoate.
| Compound Name | [2-methyl-6-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] propanoate |
|---|---|
| PubChem CID | 59581634 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | [2-methyl-6-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(C)cccc1C(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-3-11(21)23-12-8(2)5-4-6-9(12)13(22)20-14-19-10(7-24-14)15(16,17)18/h4-7H,3H2,1-2H3,(H,19,20,22) |
| InChIKey | JVOORLQZNPAJJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|