C14H11F3N2O3S — CID 59581668
[2-methyl-6-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]carbamoyl]phenyl] acetate (PubChem CID 59581668) has the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. Its IUPAC name is [2-methyl-6-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2-methyl-6-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 59581668 |
| Molecular Formula | C14H11F3N2O3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [2-methyl-6-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cccc1C(=O)Nc1csc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11F3N2O3S/c1-7-4-3-5-9(11(7)22-8(2)20)12(21)18-10-6-23-13(19-10)14(15,16)17/h3-6H,1-2H3,(H,18,21) |
| InChIKey | KZBCWGDVLSILLW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|