C13H12BrN3O5S2 — CID 25185278
[2-bromo-6-[[4-(methanesulfonamido)-1,3-thiazol-2-yl]carbamoyl]phenyl] acetate (PubChem CID 25185278) has the molecular formula C13H12BrN3O5S2 and a molecular weight of 434.29 g/mol. Its IUPAC name is [2-bromo-6-[[4-(methanesulfonamido)-1,3-thiazol-2-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2-bromo-6-[[4-(methanesulfonamido)-1,3-thiazol-2-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 25185278 |
| Molecular Formula | C13H12BrN3O5S2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 432.94 |
| IUPAC Name | [2-bromo-6-[[4-(methanesulfonamido)-1,3-thiazol-2-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Br)cccc1C(=O)Nc1nc(NS(C)(=O)=O)cs1 |
| InChI | InChI=1S/C13H12BrN3O5S2/c1-7(18)22-11-8(4-3-5-9(11)14)12(19)16-13-15-10(6-23-13)17-24(2,20)21/h3-6,17H,1-2H3,(H,15,16,19) |
| InChIKey | RUTOVCRUCXPSHK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|