C17H22N2O2S2 — CID 143777775
3,4-dimethyl-N-(5-pentan-3-ylsulfinyl-1,3-thiazol-2-yl)benzamide (PubChem CID 143777775) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 3,4-dimethyl-N-(5-pentan-3-ylsulfinyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3,4-dimethyl-N-(5-pentan-3-ylsulfinyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 143777775 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3,4-dimethyl-N-(5-pentan-3-ylsulfinyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCC(CC)S(=O)c1cnc(NC(=O)c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C17H22N2O2S2/c1-5-14(6-2)23(21)15-10-18-17(22-15)19-16(20)13-8-7-11(3)12(4)9-13/h7-10,14H,5-6H2,1-4H3,(H,18,19,20) |
| InChIKey | LXKZJMJGSBRYMV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |