C12H10N4O2S — CID 90603698
1-(5-cyano-1,3-thiazol-2-yl)-3-(3-methoxyphenyl)urea (PubChem CID 90603698) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-(5-cyano-1,3-thiazol-2-yl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(5-cyano-1,3-thiazol-2-yl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 90603698 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(5-cyano-1,3-thiazol-2-yl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ncc(C#N)s2)c1 |
| InChI | InChI=1S/C12H10N4O2S/c1-18-9-4-2-3-8(5-9)15-11(17)16-12-14-7-10(6-13)19-12/h2-5,7H,1H3,(H2,14,15,16,17) |
| InChIKey | MIAFJHWIKLBWAI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |