C9H12N4OS — CID 90603690
1-tert-butyl-3-(5-cyano-1,3-thiazol-2-yl)urea (PubChem CID 90603690) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-tert-butyl-3-(5-cyano-1,3-thiazol-2-yl)urea.
| Compound Name | 1-tert-butyl-3-(5-cyano-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 90603690 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-tert-butyl-3-(5-cyano-1,3-thiazol-2-yl)urea |
| SMILES | CC(C)(C)NC(=O)Nc1ncc(C#N)s1 |
| InChI | InChI=1S/C9H12N4OS/c1-9(2,3)13-7(14)12-8-11-5-6(4-10)15-8/h5H,1-3H3,(H2,11,12,13,14) |
| InChIKey | BBHLVIWMQBMVDG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |