C17H16ClN3O3S2 — CID 7600120
2-(4-chlorophenyl)sulfonyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)acetohydrazide (PubChem CID 7600120) has the molecular formula C17H16ClN3O3S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 7600120 |
| Molecular Formula | C17H16ClN3O3S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)acetohydrazide |
| SMILES | Cc1cc(C)c2sc(NNC(=O)CS(=O)(=O)c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C17H16ClN3O3S2/c1-10-7-11(2)16-14(8-10)19-17(25-16)21-20-15(22)9-26(23,24)13-5-3-12(18)4-6-13/h3-8H,9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | PCHSFTMGVHMVET-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|