C18H18ClN3OS2 — CID 7600122
3-(4-chlorophenyl)sulfanyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)propanehydrazide (PubChem CID 7600122) has the molecular formula C18H18ClN3OS2 and a molecular weight of 391.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)propanehydrazide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 7600122 |
| Molecular Formula | C18H18ClN3OS2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)propanehydrazide |
| SMILES | Cc1cc(C)c2sc(NNC(=O)CCSc3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C18H18ClN3OS2/c1-11-9-12(2)17-15(10-11)20-18(25-17)22-21-16(23)7-8-24-14-5-3-13(19)4-6-14/h3-6,9-10H,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | DXJGBWUDBFIISF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|