C24H17FN2O4S2 — CID 16799550
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide (PubChem CID 16799550) has the molecular formula C24H17FN2O4S2 and a molecular weight of 480.54 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 16799550 |
| Molecular Formula | C24H17FN2O4S2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(F)cc1)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C24H17FN2O4S2/c25-18-11-13-19(14-12-18)33(30,31)15-20(28)26-24-27-21(16-7-3-1-4-8-16)23(32-24)22(29)17-9-5-2-6-10-17/h1-14H,15H2,(H,26,27,28) |
| InChIKey | AJMXAQCSUUFVHG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |