C19H18F3N3OS — CID 144829885
N-cyclopentyl-6-fluoro-1,3-benzothiazol-2-amine;2,6-difluorobenzamide (PubChem CID 144829885) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is N-cyclopentyl-6-fluoro-1,3-benzothiazol-2-amine;2,6-difluorobenzamide.
| Compound Name | N-cyclopentyl-6-fluoro-1,3-benzothiazol-2-amine;2,6-difluorobenzamide |
|---|---|
| PubChem CID | 144829885 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-cyclopentyl-6-fluoro-1,3-benzothiazol-2-amine;2,6-difluorobenzamide |
| SMILES | Fc1ccc2nc(NC3CCCC3)sc2c1.NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H13FN2S.C7H5F2NO/c13-8-5-6-10-11(7-8)16-12(15-10)14-9-3-1-2-4-9;8-4-2-1-3-5(9)6(4)7(10)11/h5-7,9H,1-4H2,(H,14,15);1-3H,(H2,10,11) |
| InChIKey | GCVNTGMQZMSGBQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |