C8H7N3S3 — CID 134108840
(1,3-benzothiazol-2-ylamino)carbamodithioic acid (PubChem CID 134108840) has the molecular formula C8H7N3S3 and a molecular weight of 241.37 g/mol. Its IUPAC name is (1,3-benzothiazol-2-ylamino)carbamodithioic acid.
| Compound Name | (1,3-benzothiazol-2-ylamino)carbamodithioic acid |
|---|---|
| PubChem CID | 134108840 |
| Molecular Formula | C8H7N3S3 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | (1,3-benzothiazol-2-ylamino)carbamodithioic acid |
| SMILES | S=C(S)NNc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7N3S3/c12-8(13)11-10-7-9-5-3-1-2-4-6(5)14-7/h1-4H,(H,9,10)(H2,11,12,13) |
| InChIKey | IYCROLCLEBFFFV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|