C20H17N5O2S3 — CID 3088017
1-[4-[(1,3-benzothiazol-2-ylamino)sulfamoyl]phenyl]-3-phenylthiourea (PubChem CID 3088017) has the molecular formula C20H17N5O2S3 and a molecular weight of 455.59 g/mol. Its IUPAC name is 1-[4-[(1,3-benzothiazol-2-ylamino)sulfamoyl]phenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[(1,3-benzothiazol-2-ylamino)sulfamoyl]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3088017 |
| Molecular Formula | C20H17N5O2S3 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 1-[4-[(1,3-benzothiazol-2-ylamino)sulfamoyl]phenyl]-3-phenylthiourea |
| SMILES | O=S(=O)(NNc1nc2ccccc2s1)c1ccc(NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H17N5O2S3/c26-30(27,25-24-20-23-17-8-4-5-9-18(17)29-20)16-12-10-15(11-13-16)22-19(28)21-14-6-2-1-3-7-14/h1-13,25H,(H,23,24)(H2,21,22,28) |
| InChIKey | MGQRUGSJPCLDCV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_G(2)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|