C24H18ClN9S3 — CID 10099423
1-[4-(1,3-benzothiazol-2-ylamino)-6-[(3-chlorophenyl)carbamothioylamino]-1,3,5-triazin-2-yl]-3-phenylthiourea (PubChem CID 10099423) has the molecular formula C24H18ClN9S3 and a molecular weight of 564.13 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylamino)-6-[(3-chlorophenyl)carbamothioylamino]-1,3,5-triazin-2-yl]-3-phenylthiourea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylamino)-6-[(3-chlorophenyl)carbamothioylamino]-1,3,5-triazin-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 10099423 |
| Molecular Formula | C24H18ClN9S3 |
| Molecular Weight | 564.13 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylamino)-6-[(3-chlorophenyl)carbamothioylamino]-1,3,5-triazin-2-yl]-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)Nc1nc(NC(=S)Nc2cccc(Cl)c2)nc(Nc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C24H18ClN9S3/c25-14-7-6-10-16(13-14)27-23(36)33-20-29-19(32-22(35)26-15-8-2-1-3-9-15)30-21(31-20)34-24-28-17-11-4-5-12-18(17)37-24/h1-13H,(H5,26,27,28,29,30,31,32,33,34,35,36) |
| InChIKey | XIWDNFVZWYIXLW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.13 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|