C23H20N4O2S — CID 51125990
N-[2-[3-(1,3-benzothiazol-2-ylamino)anilino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 51125990) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is N-[2-[3-(1,3-benzothiazol-2-ylamino)anilino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-[3-(1,3-benzothiazol-2-ylamino)anilino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 51125990 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[2-[3-(1,3-benzothiazol-2-ylamino)anilino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)Nc1cccc(Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C23H20N4O2S/c28-21(13-16-7-2-1-3-8-16)24-15-22(29)25-17-9-6-10-18(14-17)26-23-27-19-11-4-5-12-20(19)30-23/h1-12,14H,13,15H2,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | RDGGWTYTORJDBB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |