C20H15FN4O3S2 — CID 46394211
1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(4-fluorophenyl)urea (PubChem CID 46394211) has the molecular formula C20H15FN4O3S2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 46394211 |
| Molecular Formula | C20H15FN4O3S2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc2sc(NS(=O)(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C20H15FN4O3S2/c21-13-6-8-14(9-7-13)22-19(26)23-15-10-11-18-17(12-15)24-20(29-18)25-30(27,28)16-4-2-1-3-5-16/h1-12H,(H,24,25)(H2,22,23,26) |
| InChIKey | XWWRSCZQGWHPOI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |