C19H22N4O4S2 — CID 46394214
1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(3-ethoxypropyl)urea (PubChem CID 46394214) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(3-ethoxypropyl)urea.
| Compound Name | 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(3-ethoxypropyl)urea |
|---|---|
| PubChem CID | 46394214 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-[2-(benzenesulfonamido)-1,3-benzothiazol-5-yl]-3-(3-ethoxypropyl)urea |
| SMILES | CCOCCCNC(=O)Nc1ccc2sc(NS(=O)(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-2-27-12-6-11-20-18(24)21-14-9-10-17-16(13-14)22-19(28-17)23-29(25,26)15-7-4-3-5-8-15/h3-5,7-10,13H,2,6,11-12H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | LYFDGQWHEPIHDT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|