C20H20N4O4S — CID 46385400
ethyl 3-[(2-benzamido-1,3-benzothiazol-5-yl)carbamoylamino]propanoate (PubChem CID 46385400) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is ethyl 3-[(2-benzamido-1,3-benzothiazol-5-yl)carbamoylamino]propanoate.
| Compound Name | ethyl 3-[(2-benzamido-1,3-benzothiazol-5-yl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 46385400 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl 3-[(2-benzamido-1,3-benzothiazol-5-yl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)Nc1ccc2sc(NC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-2-28-17(25)10-11-21-19(27)22-14-8-9-16-15(12-14)23-20(29-16)24-18(26)13-6-4-3-5-7-13/h3-9,12H,2,10-11H2,1H3,(H2,21,22,27)(H,23,24,26) |
| InChIKey | MYGIZDSVUMNJSP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |