C19H22N4O2S2 — CID 167223488
1-(3-ethoxypropyl)-3-[2-(phenylsulfanylamino)-1,3-benzothiazol-5-yl]urea (PubChem CID 167223488) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(phenylsulfanylamino)-1,3-benzothiazol-5-yl]urea.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(phenylsulfanylamino)-1,3-benzothiazol-5-yl]urea |
|---|---|
| PubChem CID | 167223488 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(phenylsulfanylamino)-1,3-benzothiazol-5-yl]urea |
| SMILES | CCOCCCNC(=O)Nc1ccc2sc(NSc3ccccc3)nc2c1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-2-25-12-6-11-20-18(24)21-14-9-10-17-16(13-14)22-19(26-17)23-27-15-7-4-3-5-8-15/h3-5,7-10,13H,2,6,11-12H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | GNYOAKCVNMSHHQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|