C23H22N4O3S2 — CID 167223525
1-(3,4-dimethoxyphenyl)-3-[2-[(4-methylphenyl)sulfanylamino]-1,3-benzothiazol-5-yl]urea (PubChem CID 167223525) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-[(4-methylphenyl)sulfanylamino]-1,3-benzothiazol-5-yl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-[(4-methylphenyl)sulfanylamino]-1,3-benzothiazol-5-yl]urea |
|---|---|
| PubChem CID | 167223525 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-[(4-methylphenyl)sulfanylamino]-1,3-benzothiazol-5-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc3sc(NSc4ccc(C)cc4)nc3c2)cc1OC |
| InChI | InChI=1S/C23H22N4O3S2/c1-14-4-8-17(9-5-14)32-27-23-26-18-12-15(7-11-21(18)31-23)24-22(28)25-16-6-10-19(29-2)20(13-16)30-3/h4-13H,1-3H3,(H,26,27)(H2,24,25,28) |
| InChIKey | GFYRIVPNKVWIFG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|