C15H17NO2S — CID 143111973
3,4-dimethoxy-N-(4-methylphenyl)sulfanylaniline (PubChem CID 143111973) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(4-methylphenyl)sulfanylaniline.
| Compound Name | 3,4-dimethoxy-N-(4-methylphenyl)sulfanylaniline |
|---|---|
| PubChem CID | 143111973 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3,4-dimethoxy-N-(4-methylphenyl)sulfanylaniline |
| SMILES | COc1ccc(NSc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C15H17NO2S/c1-11-4-7-13(8-5-11)19-16-12-6-9-14(17-2)15(10-12)18-3/h4-10,16H,1-3H3 |
| InChIKey | GFQKKONCAGERMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|