C28H35N3O2S — CID 145113430
4-[4-[(3,4-dimethoxyphenyl)methyl]-3,3-dimethylpiperazin-1-yl]-N-(4-methylphenyl)sulfanylaniline (PubChem CID 145113430) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 4-[4-[(3,4-dimethoxyphenyl)methyl]-3,3-dimethylpiperazin-1-yl]-N-(4-methylphenyl)sulfanylaniline.
| Compound Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]-3,3-dimethylpiperazin-1-yl]-N-(4-methylphenyl)sulfanylaniline |
|---|---|
| PubChem CID | 145113430 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]-3,3-dimethylpiperazin-1-yl]-N-(4-methylphenyl)sulfanylaniline |
| SMILES | COc1ccc(CN2CCN(c3ccc(NSc4ccc(C)cc4)cc3)CC2(C)C)cc1OC |
| InChI | InChI=1S/C28H35N3O2S/c1-21-6-13-25(14-7-21)34-29-23-9-11-24(12-10-23)30-16-17-31(28(2,3)20-30)19-22-8-15-26(32-4)27(18-22)33-5/h6-15,18,29H,16-17,19-20H2,1-5H3 |
| InChIKey | FLJIAKBGJRAUGX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|