C26H32N6O3S — CID 145113198
[4-[[4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfinate (PubChem CID 145113198) has the molecular formula C26H32N6O3S and a molecular weight of 508.65 g/mol. Its IUPAC name is [4-[[4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfinate.
| Compound Name | [4-[[4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 145113198 |
| Molecular Formula | C26H32N6O3S |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [4-[[4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfinate |
| SMILES | COc1cc(CN2CCN(c3ccc(/C(N)=N/NN)cc3)CC2)ccc1OS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N6O3S/c1-19-3-10-23(11-4-19)36(33)35-24-12-5-20(17-25(24)34-2)18-31-13-15-32(16-14-31)22-8-6-21(7-9-22)26(27)29-30-28/h3-12,17,30H,13-16,18,28H2,1-2H3,(H2,27,29) |
| InChIKey | DFNXCFUACKZIGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|