C29H36N2O4S — CID 145113009
2-(3,4-dimethoxyphenyl)acetaldehyde;1,2-dimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine (PubChem CID 145113009) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)acetaldehyde;1,2-dimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine.
| Compound Name | 2-(3,4-dimethoxyphenyl)acetaldehyde;1,2-dimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine |
|---|---|
| PubChem CID | 145113009 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)acetaldehyde;1,2-dimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine |
| SMILES | COc1ccc(CC=O)cc1OC.Cc1ccc(SOc2ccc(N3CCN(C)C(C)C3)cc2)cc1 |
| InChI | InChI=1S/C19H24N2OS.C10H12O3/c1-15-4-10-19(11-5-15)23-22-18-8-6-17(7-9-18)21-13-12-20(3)16(2)14-21;1-12-9-4-3-8(5-6-11)7-10(9)13-2/h4-11,16H,12-14H2,1-3H3;3-4,6-7H,5H2,1-2H3 |
| InChIKey | CQPNSXYLLCSWJJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|