C26H30FN3O2S — CID 145113361
4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]-N-(3-fluorophenyl)sulfanylaniline (PubChem CID 145113361) has the molecular formula C26H30FN3O2S and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]-N-(3-fluorophenyl)sulfanylaniline.
| Compound Name | 4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]-N-(3-fluorophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 145113361 |
| Molecular Formula | C26H30FN3O2S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]-N-(3-fluorophenyl)sulfanylaniline |
| SMILES | COc1ccc(CN2CCN(c3ccc(NSc4cccc(F)c4)cc3)C[C@@H]2C)cc1OC |
| InChI | InChI=1S/C26H30FN3O2S/c1-19-17-30(14-13-29(19)18-20-7-12-25(31-2)26(15-20)32-3)23-10-8-22(9-11-23)28-33-24-6-4-5-21(27)16-24/h4-12,15-16,19,28H,13-14,17-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | ASHCDSSQRJSQST-IBGZPJMESA-N |
| XLogP | 5.67 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|