C28H34FN3O4S — CID 145113368
N-[4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]phenyl]-N-ethyl-3-fluorobenzenesulfonamide (PubChem CID 145113368) has the molecular formula C28H34FN3O4S and a molecular weight of 527.66 g/mol. Its IUPAC name is N-[4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]phenyl]-N-ethyl-3-fluorobenzenesulfonamide.
| Compound Name | N-[4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]phenyl]-N-ethyl-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 145113368 |
| Molecular Formula | C28H34FN3O4S |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | N-[4-[(3S)-4-[(3,4-dimethoxyphenyl)methyl]-3-methylpiperazin-1-yl]phenyl]-N-ethyl-3-fluorobenzenesulfonamide |
| SMILES | CCN(c1ccc(N2CCN(Cc3ccc(OC)c(OC)c3)[C@@H](C)C2)cc1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C28H34FN3O4S/c1-5-32(37(33,34)26-8-6-7-23(29)18-26)25-12-10-24(11-13-25)31-16-15-30(21(2)19-31)20-22-9-14-27(35-3)28(17-22)36-4/h6-14,17-18,21H,5,15-16,19-20H2,1-4H3/t21-/m0/s1 |
| InChIKey | DGIUCURRMGCCHG-NRFANRHFSA-N |
| XLogP | 4.77 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|