C24H29FN6O2S — CID 145113448
4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethyl-N-(3-fluorophenyl)sulfanyl-1,3,5-triazin-2-amine (PubChem CID 145113448) has the molecular formula C24H29FN6O2S and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethyl-N-(3-fluorophenyl)sulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethyl-N-(3-fluorophenyl)sulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 145113448 |
| Molecular Formula | C24H29FN6O2S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethyl-N-(3-fluorophenyl)sulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCN(Sc1cccc(F)c1)c1ncnc(N2CCN(Cc3ccc(OC)c(OC)c3)CC2)n1 |
| InChI | InChI=1S/C24H29FN6O2S/c1-4-31(34-20-7-5-6-19(25)15-20)24-27-17-26-23(28-24)30-12-10-29(11-13-30)16-18-8-9-21(32-2)22(14-18)33-3/h5-9,14-15,17H,4,10-13,16H2,1-3H3 |
| InChIKey | VZVBUQWMWKHTCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|