C18H21Cl2N3O2 — CID 112772605
1-(3,5-dichloro-2-pyridinyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 112772605) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 112772605 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(c3ncc(Cl)cc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C18H21Cl2N3O2/c1-24-16-4-3-13(9-17(16)25-2)12-22-5-7-23(8-6-22)18-15(20)10-14(19)11-21-18/h3-4,9-11H,5-8,12H2,1-2H3 |
| InChIKey | PDVKQXPKXJMSFU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |