C11H14N4S2 — CID 30032227
[(6-propan-2-yl-1,3-benzothiazol-2-yl)amino]thiourea (PubChem CID 30032227) has the molecular formula C11H14N4S2 and a molecular weight of 266.40 g/mol. Its IUPAC name is [(6-propan-2-yl-1,3-benzothiazol-2-yl)amino]thiourea.
| Compound Name | [(6-propan-2-yl-1,3-benzothiazol-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 30032227 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [(6-propan-2-yl-1,3-benzothiazol-2-yl)amino]thiourea |
| SMILES | CC(C)c1ccc2nc(NNC(N)=S)sc2c1 |
| InChI | InChI=1S/C11H14N4S2/c1-6(2)7-3-4-8-9(5-7)17-11(13-8)15-14-10(12)16/h3-6H,1-2H3,(H,13,15)(H3,12,14,16) |
| InChIKey | QVOQRCLJXDALKN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|