C13H6ClN3S2 — CID 83077510
2-(1,3-benzothiazol-2-ylsulfanyl)-6-chloropyridine-4-carbonitrile (PubChem CID 83077510) has the molecular formula C13H6ClN3S2 and a molecular weight of 303.80 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-6-chloropyridine-4-carbonitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-6-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83077510 |
| Molecular Formula | C13H6ClN3S2 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-6-chloropyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(Sc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H6ClN3S2/c14-11-5-8(7-15)6-12(17-11)19-13-16-9-3-1-2-4-10(9)18-13/h1-6H |
| InChIKey | NUSABRAJKGPIKM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|