C15H11F3N2OS2 — CID 134085524
2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1,3-benzothiazol-6-amine (PubChem CID 134085524) has the molecular formula C15H11F3N2OS2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 134085524 |
| Molecular Formula | C15H11F3N2OS2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(SCc3ccc(OC(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C15H11F3N2OS2/c16-15(17,18)21-11-4-1-9(2-5-11)8-22-14-20-12-6-3-10(19)7-13(12)23-14/h1-7H,8,19H2 |
| InChIKey | VFTFVKHGURSSKO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|