C16H14ClN3OS2 — CID 1026672
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 1026672) has the molecular formula C16H14ClN3OS2 and a molecular weight of 363.90 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1026672 |
| Molecular Formula | C16H14ClN3OS2 |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C16H14ClN3OS2/c1-9-11(17)3-2-4-12(9)19-15(21)8-22-16-20-13-6-5-10(18)7-14(13)23-16/h2-7H,8,18H2,1H3,(H,19,21) |
| InChIKey | BHMSGONTSWNEOX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|