C12H10N4O2S2 — CID 54764573
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(1,3-oxazol-2-yl)acetamide (PubChem CID 54764573) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(1,3-oxazol-2-yl)acetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(1,3-oxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 54764573 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-(1,3-oxazol-2-yl)acetamide |
| SMILES | Nc1ccc2nc(SCC(=O)Nc3ncco3)sc2c1 |
| InChI | InChI=1S/C12H10N4O2S2/c13-7-1-2-8-9(5-7)20-12(15-8)19-6-10(17)16-11-14-3-4-18-11/h1-5H,6,13H2,(H,14,16,17) |
| InChIKey | UBOFTXGKFLDHED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|