C17H16N2O4S3 — CID 3760343
N-(1,3-benzodioxol-5-yl)-3-(1,3-benzothiazol-2-ylsulfanyl)propane-1-sulfonamide (PubChem CID 3760343) has the molecular formula C17H16N2O4S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(1,3-benzothiazol-2-ylsulfanyl)propane-1-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(1,3-benzothiazol-2-ylsulfanyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 3760343 |
| Molecular Formula | C17H16N2O4S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(1,3-benzothiazol-2-ylsulfanyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCSc1nc2ccccc2s1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O4S3/c20-26(21,19-12-6-7-14-15(10-12)23-11-22-14)9-3-8-24-17-18-13-4-1-2-5-16(13)25-17/h1-2,4-7,10,19H,3,8-9,11H2 |
| InChIKey | QRDOCKIZMQRAFO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|