C19H20N2O4S2 — CID 59286535
1-(1,3-benzodioxol-5-ylmethylamino)-4-(1,3-benzothiazol-2-ylsulfanyl)butane-1,1-diol (PubChem CID 59286535) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethylamino)-4-(1,3-benzothiazol-2-ylsulfanyl)butane-1,1-diol.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethylamino)-4-(1,3-benzothiazol-2-ylsulfanyl)butane-1,1-diol |
|---|---|
| PubChem CID | 59286535 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethylamino)-4-(1,3-benzothiazol-2-ylsulfanyl)butane-1,1-diol |
| SMILES | OC(O)(CCCSc1nc2ccccc2s1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O4S2/c22-19(23,20-11-13-6-7-15-16(10-13)25-12-24-15)8-3-9-26-18-21-14-4-1-2-5-17(14)27-18/h1-2,4-7,10,20,22-23H,3,8-9,11-12H2 |
| InChIKey | KDFYVWNFAJJWMP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|