C15H12N2O6S3 — CID 170858840
1-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylsulfanyl)-N-(4-hydroperoxyphenyl)methanesulfonamide (PubChem CID 170858840) has the molecular formula C15H12N2O6S3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylsulfanyl)-N-(4-hydroperoxyphenyl)methanesulfonamide.
| Compound Name | 1-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylsulfanyl)-N-(4-hydroperoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 170858840 |
| Molecular Formula | C15H12N2O6S3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 1-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylsulfanyl)-N-(4-hydroperoxyphenyl)methanesulfonamide |
| SMILES | O=S(=O)(CSc1nc2cc3c(cc2s1)OCO3)Nc1ccc(OO)cc1 |
| InChI | InChI=1S/C15H12N2O6S3/c18-23-10-3-1-9(2-4-10)17-26(19,20)8-24-15-16-11-5-12-13(22-7-21-12)6-14(11)25-15/h1-6,17-18H,7-8H2 |
| InChIKey | CTPIXGHBBQBBIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|