C24H25N2O3+ — CID 9318556
(5-ethyl-2,3-dioxoindol-1-yl)methyl-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium (PubChem CID 9318556) has the molecular formula C24H25N2O3+ and a molecular weight of 389.48 g/mol. Its IUPAC name is (5-ethyl-2,3-dioxoindol-1-yl)methyl-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium.
| Compound Name | (5-ethyl-2,3-dioxoindol-1-yl)methyl-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9318556 |
| Molecular Formula | C24H25N2O3+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (5-ethyl-2,3-dioxoindol-1-yl)methyl-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium |
| SMILES | CCc1ccc2c(c1)C(=O)C(=O)N2C[NH+](C)Cc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C24H24N2O3/c1-4-16-6-10-22-21(12-16)23(27)24(28)26(22)15-25(2)14-17-5-7-19-13-20(29-3)9-8-18(19)11-17/h5-13H,4,14-15H2,1-3H3/p+1 |
| InChIKey | IZLQPRKWEWGGEX-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|