C17H22N3O3+ — CID 9317334
[2-(cyclopropylamino)-2-oxoethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium (PubChem CID 9317334) has the molecular formula C17H22N3O3+ and a molecular weight of 316.38 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9317334 |
| Molecular Formula | C17H22N3O3+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium |
| SMILES | CCc1ccc2c(c1)C(=O)C(=O)N2C[NH+](C)CC(=O)NC1CC1 |
| InChI | InChI=1S/C17H21N3O3/c1-3-11-4-7-14-13(8-11)16(22)17(23)20(14)10-19(2)9-15(21)18-12-5-6-12/h4,7-8,12H,3,5-6,9-10H2,1-2H3,(H,18,21)/p+1 |
| InChIKey | FMUKIMVNHIRKGV-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|