C15H25N4O3+ — CID 9286101
[2-(cyclopropylamino)-2-oxoethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium (PubChem CID 9286101) has the molecular formula C15H25N4O3+ and a molecular weight of 309.39 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9286101 |
| Molecular Formula | C15H25N4O3+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NC1CC1)CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C15H24N4O3/c1-18(9-12(20)16-11-5-6-11)10-19-13(21)15(17-14(19)22)7-3-2-4-8-15/h11H,2-10H2,1H3,(H,16,20)(H,17,22)/p+1 |
| InChIKey | DXUMJSQGFKNVKN-UHFFFAOYSA-O |
| XLogP | -1.01 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|