C22H24N5O2+ — CID 9285141
(5-ethyl-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium (PubChem CID 9285141) has the molecular formula C22H24N5O2+ and a molecular weight of 390.47 g/mol. Its IUPAC name is (5-ethyl-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium.
| Compound Name | (5-ethyl-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 9285141 |
| Molecular Formula | C22H24N5O2+ |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (5-ethyl-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
| SMILES | CCc1ccc2c(c1)C(=O)C(=O)N2C[NH+](C)[C@@H](C)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C22H23N5O2/c1-4-16-5-10-20-19(11-16)21(28)22(29)26(20)14-25(3)15(2)17-6-8-18(9-7-17)27-13-23-12-24-27/h5-13,15H,4,14H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | AOOGDHSORPFVAS-HNNXBMFYSA-O |
| XLogP | 1.59 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|