C20H20N5O2+ — CID 9284921
(2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium (PubChem CID 9284921) has the molecular formula C20H20N5O2+ and a molecular weight of 362.41 g/mol. Its IUPAC name is (2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium.
| Compound Name | (2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 9284921 |
| Molecular Formula | C20H20N5O2+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)[NH+](C)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H19N5O2/c1-14(15-7-9-16(10-8-15)25-12-21-11-22-25)23(2)13-24-18-6-4-3-5-17(18)19(26)20(24)27/h3-12,14H,13H2,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | HXQNFJZVSGYZRU-AWEZNQCLSA-O |
| XLogP | 1.03 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|