C20H24N5O2+ — CID 11938543
[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium (PubChem CID 11938543) has the molecular formula C20H24N5O2+ and a molecular weight of 366.45 g/mol. Its IUPAC name is [(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium.
| Compound Name | [(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 11938543 |
| Molecular Formula | C20H24N5O2+ |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)[NH+](C)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C20H23N5O2/c1-14(15-7-9-16(10-8-15)25-12-21-11-22-25)23(2)13-24-19(26)17-5-3-4-6-18(17)20(24)27/h3-4,7-12,14,17-18H,5-6,13H2,1-2H3/p+1/t14-,17-,18+/m0/s1 |
| InChIKey | SHZHYNANLIUJSR-JCGIZDLHSA-O |
| XLogP | 0.75 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|