C20H19ClN5O2+ — CID 9284949
(5-chloro-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium (PubChem CID 9284949) has the molecular formula C20H19ClN5O2+ and a molecular weight of 396.86 g/mol. Its IUPAC name is (5-chloro-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium.
| Compound Name | (5-chloro-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 9284949 |
| Molecular Formula | C20H19ClN5O2+ |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (5-chloro-2,3-dioxoindol-1-yl)methyl-methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]azanium |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)[NH+](C)CN1C(=O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18ClN5O2/c1-13(14-3-6-16(7-4-14)26-11-22-10-23-26)24(2)12-25-18-8-5-15(21)9-17(18)19(27)20(25)28/h3-11,13H,12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | RRZFBFAHAXZGIX-ZDUSSCGKSA-O |
| XLogP | 1.68 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|