C18H23N6O3+ — CID 9285123
methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium (PubChem CID 9285123) has the molecular formula C18H23N6O3+ and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium.
| Compound Name | methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9285123 |
| Molecular Formula | C18H23N6O3+ |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium |
| SMILES | CC(C)N1C(=O)C(=O)N(C[NH+](C)[C@H](C)c2ccc(-n3cncn3)cc2)C1=O |
| InChI | InChI=1S/C18H22N6O3/c1-12(2)24-17(26)16(25)22(18(24)27)11-21(4)13(3)14-5-7-15(8-6-14)23-10-19-9-20-23/h5-10,12-13H,11H2,1-4H3/p+1/t13-/m1/s1 |
| InChIKey | PITGMYWKAXQASJ-CYBMUJFWSA-O |
| XLogP | -0.00 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|